About 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine
4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine (PubChem CID 55061195) has the molecular formula C13H15N5
and a molecular weight of 241.30 g/mol. Its IUPAC name is 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine |
| PubChem CID | 55061195 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine |
| SMILES | Cc1cc2nc(-c3cnn(C)c3N)[nH]c2cc1C |
| InChI | InChI=1S/C13H15N5/c1-7-4-10-11(5-8(7)2)17-13(16-10)9-6-15-18(3)12(9)14/h4-6H,14H2,1-3H3,(H,16,17) |
| InChIKey | NMFMQIZFPHUXAG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine?
The IUPAC name of 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine (CID 55061195) is 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine.
What is the SMILES notation for 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine?
The canonical SMILES for 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine is Cc1cc2nc(-c3cnn(C)c3N)[nH]c2cc1C.
What is the InChIKey of 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine?
The InChIKey is NMFMQIZFPHUXAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5/c1-7-4-10-11(5-8(7)2)17-13(16-10)9-6-15-18(3)12(9)14/h4-6H,14H2,1-3H3,(H,16,17).
What are the key properties of 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine?
4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine has a molecular weight of 241.30 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethyl-1H-benzimidazol-2-yl)-1-methylpyrazol-5-amine is sourced from PubChem (CID 55061195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).