C10H14Cl2N2O3S — CID 55062497
3-[5-chloro-4-(chloromethyl)-3-(methoxymethyl)pyrazol-1-yl]thiolane 1,1-dioxide (PubChem CID 55062497) has the molecular formula C10H14Cl2N2O3S and a molecular weight of 313.21 g/mol. Its IUPAC name is 3-[5-chloro-4-(chloromethyl)-3-(methoxymethyl)pyrazol-1-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[5-chloro-4-(chloromethyl)-3-(methoxymethyl)pyrazol-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 55062497 |
| Molecular Formula | C10H14Cl2N2O3S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 3-[5-chloro-4-(chloromethyl)-3-(methoxymethyl)pyrazol-1-yl]thiolane 1,1-dioxide |
| SMILES | COCc1nn(C2CCS(=O)(=O)C2)c(Cl)c1CCl |
| InChI | InChI=1S/C10H14Cl2N2O3S/c1-17-5-9-8(4-11)10(12)14(13-9)7-2-3-18(15,16)6-7/h7H,2-6H2,1H3 |
| InChIKey | FZARNSACXVGTJG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|