C15H21N3O — CID 55084044
2-(3-aminophenyl)-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)acetamide (PubChem CID 55084044) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)acetamide.
| Compound Name | 2-(3-aminophenyl)-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)acetamide |
|---|---|
| PubChem CID | 55084044 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-(3-aminophenyl)-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)acetamide |
| SMILES | Nc1cccc(CC(=O)NC2CCN3CCCC23)c1 |
| InChI | InChI=1S/C15H21N3O/c16-12-4-1-3-11(9-12)10-15(19)17-13-6-8-18-7-2-5-14(13)18/h1,3-4,9,13-14H,2,5-8,10,16H2,(H,17,19) |
| InChIKey | LHPYPJCTLBBUQO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|