C15H19FN2O — CID 55089579
N'-ethyl-N'-(4-fluorophenyl)-N-(furan-3-ylmethyl)ethane-1,2-diamine (PubChem CID 55089579) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is N'-ethyl-N'-(4-fluorophenyl)-N-(furan-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-(4-fluorophenyl)-N-(furan-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55089579 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N'-ethyl-N'-(4-fluorophenyl)-N-(furan-3-ylmethyl)ethane-1,2-diamine |
| SMILES | CCN(CCNCc1ccoc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O/c1-2-18(15-5-3-14(16)4-6-15)9-8-17-11-13-7-10-19-12-13/h3-7,10,12,17H,2,8-9,11H2,1H3 |
| InChIKey | FJBOXMQRQSZIAD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|