About 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid
3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid (PubChem CID 55100048) has the molecular formula C11H8FNO2S2
and a molecular weight of 269.32 g/mol. Its IUPAC name is 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid.
Analyze 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid?
The IUPAC name of 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid (CID 55100048) is 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid.
What is the SMILES notation for 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid?
The canonical SMILES for 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid is Cc1csc(Sc2c(F)cccc2C(=O)O)n1.
What is the InChIKey of 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid?
The InChIKey is HEJHSBDSMLGULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO2S2/c1-6-5-16-11(13-6)17-9-7(10(14)15)3-2-4-8(9)12/h2-5H,1H3,(H,14,15).
What are the key properties of 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid?
3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid has a molecular weight of 269.32 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid is sourced from PubChem (CID 55100048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).