C13H16N4O — CID 55109073
3-(1H-imidazol-5-ylmethylamino)-N,4-dimethylbenzamide (PubChem CID 55109073) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-(1H-imidazol-5-ylmethylamino)-N,4-dimethylbenzamide.
| Compound Name | 3-(1H-imidazol-5-ylmethylamino)-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 55109073 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-(1H-imidazol-5-ylmethylamino)-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(NCc2cnc[nH]2)c1 |
| InChI | InChI=1S/C13H16N4O/c1-9-3-4-10(13(18)14-2)5-12(9)16-7-11-6-15-8-17-11/h3-6,8,16H,7H2,1-2H3,(H,14,18)(H,15,17) |
| InChIKey | SJYYBPXZVYCGEK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |