C13H10N2O3S — CID 55145615
1-(1,3-thiazole-4-carbonyl)-2,3-dihydroindole-2-carboxylic acid (PubChem CID 55145615) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is 1-(1,3-thiazole-4-carbonyl)-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-(1,3-thiazole-4-carbonyl)-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 55145615 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1-(1,3-thiazole-4-carbonyl)-2,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2N1C(=O)c1cscn1 |
| InChI | InChI=1S/C13H10N2O3S/c16-12(9-6-19-7-14-9)15-10-4-2-1-3-8(10)5-11(15)13(17)18/h1-4,6-7,11H,5H2,(H,17,18) |
| InChIKey | SGTJOIYPCTXBEP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |