C13H15ClN4 — CID 55149396
2-chloro-5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)aniline (PubChem CID 55149396) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is 2-chloro-5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)aniline.
| Compound Name | 2-chloro-5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)aniline |
|---|---|
| PubChem CID | 55149396 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-chloro-5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)aniline |
| SMILES | Nc1cc(CN2CCn3ccnc3C2)ccc1Cl |
| InChI | InChI=1S/C13H15ClN4/c14-11-2-1-10(7-12(11)15)8-17-5-6-18-4-3-16-13(18)9-17/h1-4,7H,5-6,8-9,15H2 |
| InChIKey | DBHFXUDUDQULEZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|