C12H9Cl3N2O — CID 55168913
3-chloro-6-(2,4-dichlorophenoxy)-4,5-dimethylpyridazine (PubChem CID 55168913) has the molecular formula C12H9Cl3N2O and a molecular weight of 303.58 g/mol. Its IUPAC name is 3-chloro-6-(2,4-dichlorophenoxy)-4,5-dimethylpyridazine.
| Compound Name | 3-chloro-6-(2,4-dichlorophenoxy)-4,5-dimethylpyridazine |
|---|---|
| PubChem CID | 55168913 |
| Molecular Formula | C12H9Cl3N2O |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 3-chloro-6-(2,4-dichlorophenoxy)-4,5-dimethylpyridazine |
| SMILES | Cc1c(Cl)nnc(Oc2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C12H9Cl3N2O/c1-6-7(2)12(17-16-11(6)15)18-10-4-3-8(13)5-9(10)14/h3-5H,1-2H3 |
| InChIKey | YNKWKQGHVJQQGE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |