About 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide
4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide (PubChem CID 551851) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide.
Molecular Properties
| Compound Name | 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide |
| PubChem CID | 551851 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide |
| SMILES | C=C(CC(=C)C(=O)N(CC)CC)CN(CC)CC |
| InChI | InChI=1S/C15H28N2O/c1-7-16(8-2)12-13(5)11-14(6)15(18)17(9-3)10-4/h5-12H2,1-4H3 |
| InChIKey | NNSKSHCJBPKXGA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide?
The IUPAC name of 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide (CID 551851) is 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide.
What is the SMILES notation for 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide?
The canonical SMILES for 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide is C=C(CC(=C)C(=O)N(CC)CC)CN(CC)CC.
What is the InChIKey of 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide?
The InChIKey is NNSKSHCJBPKXGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O/c1-7-16(8-2)12-13(5)11-14(6)15(18)17(9-3)10-4/h5-12H2,1-4H3.
What are the key properties of 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide?
4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide has a molecular weight of 252.40 g/mol, XLogP of 2.70, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylaminomethyl)-N,N-diethyl-2-methylidenepent-4-enamide is sourced from PubChem (CID 551851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).