C12H11Cl5O2 — CID 55221058
6-(2,3,4,5,6-pentachlorophenoxy)hexan-2-one (PubChem CID 55221058) has the molecular formula C12H11Cl5O2 and a molecular weight of 364.48 g/mol. Its IUPAC name is 6-(2,3,4,5,6-pentachlorophenoxy)hexan-2-one.
| Compound Name | 6-(2,3,4,5,6-pentachlorophenoxy)hexan-2-one |
|---|---|
| PubChem CID | 55221058 |
| Molecular Formula | C12H11Cl5O2 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | 6-(2,3,4,5,6-pentachlorophenoxy)hexan-2-one |
| SMILES | CC(=O)CCCCOc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H11Cl5O2/c1-6(18)4-2-3-5-19-12-10(16)8(14)7(13)9(15)11(12)17/h2-5H2,1H3 |
| InChIKey | ACLYLVCWJYEUEP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|