C14H18BrClO2 — CID 55223851
5-bromo-1-chloro-3,4-dimethoxy-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 55223851) has the molecular formula C14H18BrClO2 and a molecular weight of 333.65 g/mol. Its IUPAC name is 5-bromo-1-chloro-3,4-dimethoxy-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 5-bromo-1-chloro-3,4-dimethoxy-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 55223851 |
| Molecular Formula | C14H18BrClO2 |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 5-bromo-1-chloro-3,4-dimethoxy-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | COc1cc(Cl)c2c(c1OC)C(Br)CC(C)CC2 |
| InChI | InChI=1S/C14H18BrClO2/c1-8-4-5-9-11(16)7-12(17-2)14(18-3)13(9)10(15)6-8/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | RTMZFCMRMATDFQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|