C16H22Cl2O2 — CID 63512509
1,5-dichloro-3,4-diethoxy-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 63512509) has the molecular formula C16H22Cl2O2 and a molecular weight of 317.26 g/mol. Its IUPAC name is 1,5-dichloro-3,4-diethoxy-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 1,5-dichloro-3,4-diethoxy-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 63512509 |
| Molecular Formula | C16H22Cl2O2 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1,5-dichloro-3,4-diethoxy-7-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | CCOc1cc(Cl)c2c(c1OCC)C(Cl)CC(C)CC2 |
| InChI | InChI=1S/C16H22Cl2O2/c1-4-19-14-9-12(17)11-7-6-10(3)8-13(18)15(11)16(14)20-5-2/h9-10,13H,4-8H2,1-3H3 |
| InChIKey | CRVQRDXWXIFGAN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|