C14H16ClN3O — CID 55229088
4-chloro-2,5-dimethyl-6-(3-pyridin-4-ylpropoxy)pyrimidine (PubChem CID 55229088) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is 4-chloro-2,5-dimethyl-6-(3-pyridin-4-ylpropoxy)pyrimidine.
| Compound Name | 4-chloro-2,5-dimethyl-6-(3-pyridin-4-ylpropoxy)pyrimidine |
|---|---|
| PubChem CID | 55229088 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-chloro-2,5-dimethyl-6-(3-pyridin-4-ylpropoxy)pyrimidine |
| SMILES | Cc1nc(Cl)c(C)c(OCCCc2ccncc2)n1 |
| InChI | InChI=1S/C14H16ClN3O/c1-10-13(15)17-11(2)18-14(10)19-9-3-4-12-5-7-16-8-6-12/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | QNVBTZRVPSQQTG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|