About 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine
4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine (PubChem CID 66232023) has the molecular formula C12H19ClN2O
and a molecular weight of 242.75 g/mol. Its IUPAC name is 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine |
| PubChem CID | 66232023 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine |
| SMILES | Cc1nc(Cl)c(C)c(OCCC(C)(C)C)n1 |
| InChI | InChI=1S/C12H19ClN2O/c1-8-10(13)14-9(2)15-11(8)16-7-6-12(3,4)5/h6-7H2,1-5H3 |
| InChIKey | VYOCLZBPFPNHDF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine?
The IUPAC name of 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine (CID 66232023) is 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine.
What is the SMILES notation for 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine?
The canonical SMILES for 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine is Cc1nc(Cl)c(C)c(OCCC(C)(C)C)n1.
What is the InChIKey of 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine?
The InChIKey is VYOCLZBPFPNHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClN2O/c1-8-10(13)14-9(2)15-11(8)16-7-6-12(3,4)5/h6-7H2,1-5H3.
What are the key properties of 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine?
4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine has a molecular weight of 242.75 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine is sourced from PubChem (CID 66232023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).