C12H19ClN2O — CID 66232023
4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine (PubChem CID 66232023) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine.
| Compound Name | 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine |
|---|---|
| PubChem CID | 66232023 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-chloro-6-(3,3-dimethylbutoxy)-2,5-dimethylpyrimidine |
| SMILES | Cc1nc(Cl)c(C)c(OCCC(C)(C)C)n1 |
| InChI | InChI=1S/C12H19ClN2O/c1-8-10(13)14-9(2)15-11(8)16-7-6-12(3,4)5/h6-7H2,1-5H3 |
| InChIKey | VYOCLZBPFPNHDF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |