C16H19ClN2O — CID 61269144
3-(chloromethyl)-4,6-dimethyl-2-(3-pyridin-4-ylpropoxy)pyridine (PubChem CID 61269144) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is 3-(chloromethyl)-4,6-dimethyl-2-(3-pyridin-4-ylpropoxy)pyridine.
| Compound Name | 3-(chloromethyl)-4,6-dimethyl-2-(3-pyridin-4-ylpropoxy)pyridine |
|---|---|
| PubChem CID | 61269144 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-(chloromethyl)-4,6-dimethyl-2-(3-pyridin-4-ylpropoxy)pyridine |
| SMILES | Cc1cc(C)c(CCl)c(OCCCc2ccncc2)n1 |
| InChI | InChI=1S/C16H19ClN2O/c1-12-10-13(2)19-16(15(12)11-17)20-9-3-4-14-5-7-18-8-6-14/h5-8,10H,3-4,9,11H2,1-2H3 |
| InChIKey | CYLZQPNIURYCQB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|