About 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine
3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine (PubChem CID 55200335) has the molecular formula C16H18ClNO
and a molecular weight of 275.78 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine |
| PubChem CID | 55200335 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine |
| SMILES | Cc1cc(C)c(CCl)c(Oc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C16H18ClNO/c1-10-5-6-14(8-11(10)2)19-16-15(9-17)12(3)7-13(4)18-16/h5-8H,9H2,1-4H3 |
| InChIKey | SSENLJCGUMIPLE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine?
The IUPAC name of 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine (CID 55200335) is 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine.
What is the SMILES notation for 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine?
The canonical SMILES for 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine is Cc1cc(C)c(CCl)c(Oc2ccc(C)c(C)c2)n1.
What is the InChIKey of 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine?
The InChIKey is SSENLJCGUMIPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClNO/c1-10-5-6-14(8-11(10)2)19-16-15(9-17)12(3)7-13(4)18-16/h5-8H,9H2,1-4H3.
What are the key properties of 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine?
3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine has a molecular weight of 275.78 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine is sourced from PubChem (CID 55200335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).