C16H18ClNO — CID 55200335
3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine (PubChem CID 55200335) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine.
| Compound Name | 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 55200335 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-(chloromethyl)-2-(3,4-dimethylphenoxy)-4,6-dimethylpyridine |
| SMILES | Cc1cc(C)c(CCl)c(Oc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C16H18ClNO/c1-10-5-6-14(8-11(10)2)19-16-15(9-17)12(3)7-13(4)18-16/h5-8H,9H2,1-4H3 |
| InChIKey | SSENLJCGUMIPLE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|