C15H15BrClNO — CID 63446420
2-(2-bromo-4-methylphenoxy)-3-(chloromethyl)-4,6-dimethylpyridine (PubChem CID 63446420) has the molecular formula C15H15BrClNO and a molecular weight of 340.65 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-3-(chloromethyl)-4,6-dimethylpyridine.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-3-(chloromethyl)-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 63446420 |
| Molecular Formula | C15H15BrClNO |
| Molecular Weight | 340.65 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-3-(chloromethyl)-4,6-dimethylpyridine |
| SMILES | Cc1ccc(Oc2nc(C)cc(C)c2CCl)c(Br)c1 |
| InChI | InChI=1S/C15H15BrClNO/c1-9-4-5-14(13(16)6-9)19-15-12(8-17)10(2)7-11(3)18-15/h4-7H,8H2,1-3H3 |
| InChIKey | ZZRAHUZPJYZJPC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|