C17H20ClNO — CID 63446366
3-(chloromethyl)-4,6-dimethyl-2-(4-propan-2-ylphenoxy)pyridine (PubChem CID 63446366) has the molecular formula C17H20ClNO and a molecular weight of 289.81 g/mol. Its IUPAC name is 3-(chloromethyl)-4,6-dimethyl-2-(4-propan-2-ylphenoxy)pyridine.
| Compound Name | 3-(chloromethyl)-4,6-dimethyl-2-(4-propan-2-ylphenoxy)pyridine |
|---|---|
| PubChem CID | 63446366 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-(chloromethyl)-4,6-dimethyl-2-(4-propan-2-ylphenoxy)pyridine |
| SMILES | Cc1cc(C)c(CCl)c(Oc2ccc(C(C)C)cc2)n1 |
| InChI | InChI=1S/C17H20ClNO/c1-11(2)14-5-7-15(8-6-14)20-17-16(10-18)12(3)9-13(4)19-17/h5-9,11H,10H2,1-4H3 |
| InChIKey | KWLKUGZAQUDLKG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|