C15H14Br2ClNO2 — CID 79406784
3-(chloromethyl)-2-(2,5-dibromo-4-methoxyphenoxy)-4,6-dimethylpyridine (PubChem CID 79406784) has the molecular formula C15H14Br2ClNO2 and a molecular weight of 435.54 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(2,5-dibromo-4-methoxyphenoxy)-4,6-dimethylpyridine.
| Compound Name | 3-(chloromethyl)-2-(2,5-dibromo-4-methoxyphenoxy)-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 79406784 |
| Molecular Formula | C15H14Br2ClNO2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 432.91 |
| IUPAC Name | 3-(chloromethyl)-2-(2,5-dibromo-4-methoxyphenoxy)-4,6-dimethylpyridine |
| SMILES | COc1cc(Br)c(Oc2nc(C)cc(C)c2CCl)cc1Br |
| InChI | InChI=1S/C15H14Br2ClNO2/c1-8-4-9(2)19-15(10(8)7-18)21-14-6-11(16)13(20-3)5-12(14)17/h4-6H,7H2,1-3H3 |
| InChIKey | AXFMRNNUZUKQFL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|