C10H11N5O4 — CID 55240542
1-[(1-ethylpyrazol-4-yl)methyl]-5-nitropyrimidine-2,4-dione (PubChem CID 55240542) has the molecular formula C10H11N5O4 and a molecular weight of 265.23 g/mol. Its IUPAC name is 1-[(1-ethylpyrazol-4-yl)methyl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-[(1-ethylpyrazol-4-yl)methyl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55240542 |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1-[(1-ethylpyrazol-4-yl)methyl]-5-nitropyrimidine-2,4-dione |
| SMILES | CCn1cc(Cn2cc([N+](=O)[O-])c(=O)[nH]c2=O)cn1 |
| InChI | InChI=1S/C10H11N5O4/c1-2-14-5-7(3-11-14)4-13-6-8(15(18)19)9(16)12-10(13)17/h3,5-6H,2,4H2,1H3,(H,12,16,17) |
| InChIKey | XULSCLNIUODANK-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|