C11H17N3O2S — CID 55242116
1,3-dimethyl-5-(oxolan-2-ylmethoxy)pyrazole-4-carbothioamide (PubChem CID 55242116) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1,3-dimethyl-5-(oxolan-2-ylmethoxy)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(oxolan-2-ylmethoxy)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 55242116 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1,3-dimethyl-5-(oxolan-2-ylmethoxy)pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(OCC2CCCO2)c1C(N)=S |
| InChI | InChI=1S/C11H17N3O2S/c1-7-9(10(12)17)11(14(2)13-7)16-6-8-4-3-5-15-8/h8H,3-6H2,1-2H3,(H2,12,17) |
| InChIKey | FOESAWWLELJODB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|