C8H12N8S — CID 55243104
1,3-dimethyl-5-(1-methyltetrazol-5-yl)sulfanylpyrazole-4-carboximidamide (PubChem CID 55243104) has the molecular formula C8H12N8S and a molecular weight of 252.31 g/mol. Its IUPAC name is 1,3-dimethyl-5-(1-methyltetrazol-5-yl)sulfanylpyrazole-4-carboximidamide.
| Compound Name | 1,3-dimethyl-5-(1-methyltetrazol-5-yl)sulfanylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 55243104 |
| Molecular Formula | C8H12N8S |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1,3-dimethyl-5-(1-methyltetrazol-5-yl)sulfanylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1Sc1nnnn1C |
| InChI | InChI=1S/C8H12N8S/c1-4-5(6(9)10)7(15(2)12-4)17-8-11-13-14-16(8)3/h1-3H3,(H3,9,10) |
| InChIKey | UOPBLCWKOYUFSA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|