C12H13N7 — CID 63751375
5-(benzotriazol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 63751375) has the molecular formula C12H13N7 and a molecular weight of 255.29 g/mol. Its IUPAC name is 5-(benzotriazol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-(benzotriazol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 63751375 |
| Molecular Formula | C12H13N7 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 5-(benzotriazol-1-yl)-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1-n1nnc2ccccc21 |
| InChI | InChI=1S/C12H13N7/c1-7-10(11(13)14)12(18(2)16-7)19-9-6-4-3-5-8(9)15-17-19/h3-6H,1-2H3,(H3,13,14) |
| InChIKey | BJSNUPGUAHZFKR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|