C6H7ClO3 — CID 55253211
(1R,4S,6R)-4-(chloromethyl)-3,7-dioxabicyclo[4.1.0]heptan-2-one (PubChem CID 55253211) has the molecular formula C6H7ClO3 and a molecular weight of 162.57 g/mol. Its IUPAC name is (1R,4S,6R)-4-(chloromethyl)-3,7-dioxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1R,4S,6R)-4-(chloromethyl)-3,7-dioxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 55253211 |
| Molecular Formula | C6H7ClO3 |
| Molecular Weight | 162.57 g/mol |
| Exact Mass | 162.01 |
| IUPAC Name | (1R,4S,6R)-4-(chloromethyl)-3,7-dioxabicyclo[4.1.0]heptan-2-one |
| SMILES | O=C1O[C@H](CCl)C[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C6H7ClO3/c7-2-3-1-4-5(10-4)6(8)9-3/h3-5H,1-2H2/t3-,4+,5+/m0/s1 |
| InChIKey | HQYGUUVREGEIKN-VPENINKCSA-N |
| XLogP | 0.31 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.57 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|