About (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one
(1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one (PubChem CID 14557073) has the molecular formula C4H4O3
and a molecular weight of 100.07 g/mol. Its IUPAC name is (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one.
Molecular Properties
| Compound Name | (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one |
| PubChem CID | 14557073 |
| Molecular Formula | C4H4O3 |
| Molecular Weight | 100.07 g/mol |
| Exact Mass | 100.02 |
| IUPAC Name | (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1OC[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C4H4O3/c5-4-3-2(7-3)1-6-4/h2-3H,1H2/t2-,3-/m1/s1 |
| InChIKey | ZEHAHQNJTOLTDB-PWNYCUMCSA-N |
| XLogP | -0.69 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.07 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one?
The IUPAC name of (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one (CID 14557073) is (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one.
What is the SMILES notation for (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one?
The canonical SMILES for (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one is O=C1OC[C@H]2O[C@@H]12.
What is the InChIKey of (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one?
The InChIKey is ZEHAHQNJTOLTDB-PWNYCUMCSA-N. The full InChI is InChI=1S/C4H4O3/c5-4-3-2(7-3)1-6-4/h2-3H,1H2/t2-,3-/m1/s1.
What are the key properties of (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one?
(1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one has a molecular weight of 100.07 g/mol, XLogP of -0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-one is sourced from PubChem (CID 14557073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).