C7H11NO4 — CID 90920326
(2S,4aR)-2-methoxy-2,3,4,4a,7,7a-hexahydrofuro[3,4-b][1,4]oxazin-5-one (PubChem CID 90920326) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is (2S,4aR)-2-methoxy-2,3,4,4a,7,7a-hexahydrofuro[3,4-b][1,4]oxazin-5-one.
| Compound Name | (2S,4aR)-2-methoxy-2,3,4,4a,7,7a-hexahydrofuro[3,4-b][1,4]oxazin-5-one |
|---|---|
| PubChem CID | 90920326 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (2S,4aR)-2-methoxy-2,3,4,4a,7,7a-hexahydrofuro[3,4-b][1,4]oxazin-5-one |
| SMILES | CO[C@@H]1CN[C@H]2C(=O)OCC2O1 |
| InChI | InChI=1S/C7H11NO4/c1-10-5-2-8-6-4(12-5)3-11-7(6)9/h4-6,8H,2-3H2,1H3/t4?,5-,6+/m0/s1 |
| InChIKey | IFJLNGOJRQQTCO-DUAGOPDLSA-N |
| XLogP | -1.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |