C4H6O2S2 — CID 87332773
3,4-bis(sulfanyl)oxolan-2-one (PubChem CID 87332773) has the molecular formula C4H6O2S2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3,4-bis(sulfanyl)oxolan-2-one.
| Compound Name | 3,4-bis(sulfanyl)oxolan-2-one |
|---|---|
| PubChem CID | 87332773 |
| Molecular Formula | C4H6O2S2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 149.98 |
| IUPAC Name | 3,4-bis(sulfanyl)oxolan-2-one |
| SMILES | O=C1OCC(S)C1S |
| InChI | InChI=1S/C4H6O2S2/c5-4-3(8)2(7)1-6-4/h2-3,7-8H,1H2 |
| InChIKey | SYWTVQYXXCXVSX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|