C10H13N3O5S — CID 55258153
1-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-2-carbaldehyde (PubChem CID 55258153) has the molecular formula C10H13N3O5S and a molecular weight of 287.30 g/mol. Its IUPAC name is 1-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-2-carbaldehyde.
| Compound Name | 1-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 55258153 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]piperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1S(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13N3O5S/c14-6-7-3-1-2-4-13(7)19(17,18)8-5-11-10(16)12-9(8)15/h5-7H,1-4H2,(H2,11,12,15,16) |
| InChIKey | LMQSCFIFQSGVCW-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|