C10H9N5 — CID 55263306
3-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]benzonitrile (PubChem CID 55263306) has the molecular formula C10H9N5 and a molecular weight of 199.22 g/mol. Its IUPAC name is 3-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]benzonitrile.
| Compound Name | 3-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 55263306 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 3-[5-(aminomethyl)-1H-1,2,4-triazol-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2n[nH]c(CN)n2)c1 |
| InChI | InChI=1S/C10H9N5/c11-5-7-2-1-3-8(4-7)10-13-9(6-12)14-15-10/h1-4H,6,12H2,(H,13,14,15) |
| InChIKey | SYWJQFGNVURVRF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |