C5H11N3O — CID 55289015
2-(2-amino-4,5-dihydroimidazol-1-yl)ethanol (PubChem CID 55289015) has the molecular formula C5H11N3O and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-(2-amino-4,5-dihydroimidazol-1-yl)ethanol.
| Compound Name | 2-(2-amino-4,5-dihydroimidazol-1-yl)ethanol |
|---|---|
| PubChem CID | 55289015 |
| Molecular Formula | C5H11N3O |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | 2-(2-amino-4,5-dihydroimidazol-1-yl)ethanol |
| SMILES | NC1=NCCN1CCO |
| InChI | InChI=1S/C5H11N3O/c6-5-7-1-2-8(5)3-4-9/h9H,1-4H2,(H2,6,7) |
| InChIKey | GQYFHQVHRGXTHR-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |