C6H13N3O — CID 57054713
1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine (PubChem CID 57054713) has the molecular formula C6H13N3O and a molecular weight of 143.19 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 57054713 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 1-(2-methoxyethyl)-4,5-dihydroimidazol-2-amine |
| SMILES | COCCN1CCN=C1N |
| InChI | InChI=1S/C6H13N3O/c1-10-5-4-9-3-2-8-6(9)7/h2-5H2,1H3,(H2,7,8) |
| InChIKey | TWBAFDXKMURDNN-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |