About (Z)-3-amino-2,3-dichloroprop-2-enenitrile
(Z)-3-amino-2,3-dichloroprop-2-enenitrile (PubChem CID 55290271) has the molecular formula C3H2Cl2N2
and a molecular weight of 136.97 g/mol. Its IUPAC name is (Z)-3-amino-2,3-dichloroprop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-3-amino-2,3-dichloroprop-2-enenitrile |
| PubChem CID | 55290271 |
| Molecular Formula | C3H2Cl2N2 |
| Molecular Weight | 136.97 g/mol |
| Exact Mass | 135.96 |
| IUPAC Name | (Z)-3-amino-2,3-dichloroprop-2-enenitrile |
| SMILES | N#C/C(Cl)=C(\N)Cl |
| InChI | InChI=1S/C3H2Cl2N2/c4-2(1-6)3(5)7/h7H2/b3-2+ |
| InChIKey | PNKSPWGMYYNANA-NSCUHMNNSA-N |
| XLogP | 1.12 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.97 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-2,3-dichloroprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-2,3-dichloroprop-2-enenitrile?
The IUPAC name of (Z)-3-amino-2,3-dichloroprop-2-enenitrile (CID 55290271) is (Z)-3-amino-2,3-dichloroprop-2-enenitrile.
What is the SMILES notation for (Z)-3-amino-2,3-dichloroprop-2-enenitrile?
The canonical SMILES for (Z)-3-amino-2,3-dichloroprop-2-enenitrile is N#C/C(Cl)=C(\N)Cl.
What is the InChIKey of (Z)-3-amino-2,3-dichloroprop-2-enenitrile?
The InChIKey is PNKSPWGMYYNANA-NSCUHMNNSA-N. The full InChI is InChI=1S/C3H2Cl2N2/c4-2(1-6)3(5)7/h7H2/b3-2+.
What are the key properties of (Z)-3-amino-2,3-dichloroprop-2-enenitrile?
(Z)-3-amino-2,3-dichloroprop-2-enenitrile has a molecular weight of 136.97 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-2,3-dichloroprop-2-enenitrile is sourced from PubChem (CID 55290271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).