C12Cl6N4S — CID 88710403
2,3,5-trichloro-4-(1,3,4-trichloro-1,4-dicyanobuta-1,3-dien-2-yl)sulfanylhexa-2,4-dienedinitrile (PubChem CID 88710403) has the molecular formula C12Cl6N4S and a molecular weight of 444.95 g/mol. Its IUPAC name is 2,3,5-trichloro-4-(1,3,4-trichloro-1,4-dicyanobuta-1,3-dien-2-yl)sulfanylhexa-2,4-dienedinitrile.
| Compound Name | 2,3,5-trichloro-4-(1,3,4-trichloro-1,4-dicyanobuta-1,3-dien-2-yl)sulfanylhexa-2,4-dienedinitrile |
|---|---|
| PubChem CID | 88710403 |
| Molecular Formula | C12Cl6N4S |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 441.80 |
| IUPAC Name | 2,3,5-trichloro-4-(1,3,4-trichloro-1,4-dicyanobuta-1,3-dien-2-yl)sulfanylhexa-2,4-dienedinitrile |
| SMILES | N#CC(Cl)=C(Cl)C(SC(=C(Cl)C#N)C(Cl)=C(Cl)C#N)=C(Cl)C#N |
| InChI | InChI=1S/C12Cl6N4S/c13-5(1-19)9(17)11(7(15)3-21)23-12(8(16)4-22)10(18)6(14)2-20 |
| InChIKey | VVTLURQBUHMMFN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|