C4Cl2N2 — CID 134987690
(Z)-2,3-dichloro-3-isocyanoprop-2-enenitrile (PubChem CID 134987690) has the molecular formula C4Cl2N2 and a molecular weight of 146.96 g/mol. Its IUPAC name is (Z)-2,3-dichloro-3-isocyanoprop-2-enenitrile.
| Compound Name | (Z)-2,3-dichloro-3-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 134987690 |
| Molecular Formula | C4Cl2N2 |
| Molecular Weight | 146.96 g/mol |
| Exact Mass | 145.94 |
| IUPAC Name | (Z)-2,3-dichloro-3-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(Cl)=C(/Cl)C#N |
| InChI | InChI=1S/C4Cl2N2/c1-8-4(6)3(5)2-7/b4-3+ |
| InChIKey | XNLVCOYBOBZPFF-ONEGZZNKSA-N |
| XLogP | 2.08 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.96 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|