About disodium;1-cyano-2-isocyanoethenethiolate;sulfanide
disodium;1-cyano-2-isocyanoethenethiolate;sulfanide (PubChem CID 140604501) has the molecular formula C4HN2Na2S2-
and a molecular weight of 187.18 g/mol. Its IUPAC name is disodium;1-cyano-2-isocyanoethenethiolate;sulfanide.
Molecular Properties
| Compound Name | disodium;1-cyano-2-isocyanoethenethiolate;sulfanide |
| PubChem CID | 140604501 |
| Molecular Formula | C4HN2Na2S2- |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 186.94 |
| IUPAC Name | disodium;1-cyano-2-isocyanoethenethiolate;sulfanide |
| SMILES | [C-]#[N+]/[C-]=C(\[S-])C#N.[Na+].[Na+].[SH-] |
| InChI | InChI=1S/C4HN2S.2Na.H2S/c1-6-3-4(7)2-5;;;/h7H;;;1H2/q-1;2*+1;/p-2 |
| InChIKey | POEGTNHDCHNONC-UHFFFAOYSA-L |
| XLogP | -5.64 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | -5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;1-cyano-2-isocyanoethenethiolate;sulfanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;1-cyano-2-isocyanoethenethiolate;sulfanide?
The IUPAC name of disodium;1-cyano-2-isocyanoethenethiolate;sulfanide (CID 140604501) is disodium;1-cyano-2-isocyanoethenethiolate;sulfanide.
What is the SMILES notation for disodium;1-cyano-2-isocyanoethenethiolate;sulfanide?
The canonical SMILES for disodium;1-cyano-2-isocyanoethenethiolate;sulfanide is [C-]#[N+]/[C-]=C(\[S-])C#N.[Na+].[Na+].[SH-].
What is the InChIKey of disodium;1-cyano-2-isocyanoethenethiolate;sulfanide?
The InChIKey is POEGTNHDCHNONC-UHFFFAOYSA-L. The full InChI is InChI=1S/C4HN2S.2Na.H2S/c1-6-3-4(7)2-5;;;/h7H;;;1H2/q-1;2*+1;/p-2.
What are the key properties of disodium;1-cyano-2-isocyanoethenethiolate;sulfanide?
disodium;1-cyano-2-isocyanoethenethiolate;sulfanide has a molecular weight of 187.18 g/mol, XLogP of -5.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;1-cyano-2-isocyanoethenethiolate;sulfanide is sourced from PubChem (CID 140604501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).