C14H4N4O2 — CID 171734518
2-[(5E)-5-[5-(diisocyanomethylidene)furan-2-ylidene]furan-2-ylidene]propanedinitrile (PubChem CID 171734518) has the molecular formula C14H4N4O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is 2-[(5E)-5-[5-(diisocyanomethylidene)furan-2-ylidene]furan-2-ylidene]propanedinitrile.
| Compound Name | 2-[(5E)-5-[5-(diisocyanomethylidene)furan-2-ylidene]furan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 171734518 |
| Molecular Formula | C14H4N4O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-[(5E)-5-[5-(diisocyanomethylidene)furan-2-ylidene]furan-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=c1cc/c(=c2/ccc(=C(C#N)C#N)o2)o1 |
| InChI | InChI=1S/C14H4N4O2/c1-17-14(18-2)13-6-5-12(20-13)11-4-3-10(19-11)9(7-15)8-16/h3-6H/b12-11+ |
| InChIKey | LGDHFQPWWONXLR-VAWYXSNFSA-N |
| XLogP | 1.26 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|