C12H2F4N4 — CID 140750591
2-[4-(diisocyanomethylidene)-2,3,5,6-tetrafluorocyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 140750591) has the molecular formula C12H2F4N4 and a molecular weight of 278.17 g/mol. Its IUPAC name is 2-[4-(diisocyanomethylidene)-2,3,5,6-tetrafluorocyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[4-(diisocyanomethylidene)-2,3,5,6-tetrafluorocyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 140750591 |
| Molecular Formula | C12H2F4N4 |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 2-[4-(diisocyanomethylidene)-2,3,5,6-tetrafluorocyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1C(F)=C(F)C(=C(C#N)C#N)C(F)C1F |
| InChI | InChI=1S/C12H2F4N4/c1-19-12(20-2)7-10(15)8(13)6(5(3-17)4-18)9(14)11(7)16/h8,10H |
| InChIKey | HVAZHVFFXAKMNE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|