C14H8N4O2 — CID 22090418
2-[4-(diisocyanomethylidene)-2,5-dimethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile (PubChem CID 22090418) has the molecular formula C14H8N4O2 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-[4-(diisocyanomethylidene)-2,5-dimethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile.
| Compound Name | 2-[4-(diisocyanomethylidene)-2,5-dimethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 22090418 |
| Molecular Formula | C14H8N4O2 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-[4-(diisocyanomethylidene)-2,5-dimethoxycyclohexa-2,5-dien-1-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=c1cc(OC)c(=C(C#N)C#N)cc1OC |
| InChI | InChI=1S/C14H8N4O2/c1-17-14(18-2)11-6-12(19-3)10(5-13(11)20-4)9(7-15)8-16/h5-6H,3-4H3 |
| InChIKey | UKTNONAALOPASU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|