C15H10N4O6S — CID 59032528
2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-methoxycyclohexa-1,4-dien-1-yl]oxyethyl hydrogen sulfate (PubChem CID 59032528) has the molecular formula C15H10N4O6S and a molecular weight of 374.33 g/mol. Its IUPAC name is 2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-methoxycyclohexa-1,4-dien-1-yl]oxyethyl hydrogen sulfate.
| Compound Name | 2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-methoxycyclohexa-1,4-dien-1-yl]oxyethyl hydrogen sulfate |
|---|---|
| PubChem CID | 59032528 |
| Molecular Formula | C15H10N4O6S |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-methoxycyclohexa-1,4-dien-1-yl]oxyethyl hydrogen sulfate |
| SMILES | [C-]#[N+]/C(C#N)=c1/cc(OCCOS(=O)(=O)O)/c(=C(\C#N)[N+]#[C-])cc1OC |
| InChI | InChI=1S/C15H10N4O6S/c1-18-12(8-16)10-7-15(24-4-5-25-26(20,21)22)11(6-14(10)23-3)13(9-17)19-2/h6-7H,4-5H2,3H3,(H,20,21,22)/b12-10-,13-11+ |
| InChIKey | JUCSFLYKGOZKFP-PJABCKPXSA-N |
| XLogP | -0.00 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|