C34H30N4O12S2 — CID 59032565
2-[4-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[4-[2-(trihydroxy-λ4-sulfanyl)benzoyl]oxybutoxy]cyclohexa-1,4-dien-1-yl]oxybutoxycarbonyl]benzenesulfonic acid (PubChem CID 59032565) has the molecular formula C34H30N4O12S2 and a molecular weight of 750.76 g/mol. Its IUPAC name is 2-[4-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[4-[2-(trihydroxy-λ4-sulfanyl)benzoyl]oxybutoxy]cyclohexa-1,4-dien-1-yl]oxybutoxycarbonyl]benzenesulfonic acid.
| Compound Name | 2-[4-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[4-[2-(trihydroxy-λ4-sulfanyl)benzoyl]oxybutoxy]cyclohexa-1,4-dien-1-yl]oxybutoxycarbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59032565 |
| Molecular Formula | C34H30N4O12S2 |
| Molecular Weight | 750.76 g/mol |
| Exact Mass | 750.13 |
| IUPAC Name | 2-[4-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[4-[2-(trihydroxy-λ4-sulfanyl)benzoyl]oxybutoxy]cyclohexa-1,4-dien-1-yl]oxybutoxycarbonyl]benzenesulfonic acid |
| SMILES | [C-]#[N+]/C(C#N)=c1/cc(OCCCCOC(=O)c2ccccc2S(=O)(=O)O)/c(=C(\C#N)[N+]#[C-])cc1OCCCCOC(=O)c1ccccc1S(O)(O)O |
| InChI | InChI=1S/C34H30N4O12S2/c1-37-27(21-35)25-19-30(48-16-8-10-18-50-34(40)24-12-4-6-14-32(24)52(44,45)46)26(28(22-36)38-2)20-29(25)47-15-7-9-17-49-33(39)23-11-3-5-13-31(23)51(41,42)43/h3-6,11-14,19-20,41-43H,7-10,15-18H2,(H,44,45,46)/b27-25-,28-26+ |
| InChIKey | HCKCTUGKWABJNV-ZQZMJUSDSA-N |
| XLogP | 4.65 |
| TPSA | 242.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.76 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|