C32H24N4O12S2 — CID 88893478
2-[2-[3,6-bis(dicyanomethylidene)-4-[2-(4-methyl-2-sulfobenzoyl)oxyethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxycarbonyl]-5-methylbenzenesulfonic acid (PubChem CID 88893478) has the molecular formula C32H24N4O12S2 and a molecular weight of 720.69 g/mol. Its IUPAC name is 2-[2-[3,6-bis(dicyanomethylidene)-4-[2-(4-methyl-2-sulfobenzoyl)oxyethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxycarbonyl]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[2-[3,6-bis(dicyanomethylidene)-4-[2-(4-methyl-2-sulfobenzoyl)oxyethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxycarbonyl]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88893478 |
| Molecular Formula | C32H24N4O12S2 |
| Molecular Weight | 720.69 g/mol |
| Exact Mass | 720.08 |
| IUPAC Name | 2-[2-[3,6-bis(dicyanomethylidene)-4-[2-(4-methyl-2-sulfobenzoyl)oxyethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxycarbonyl]-5-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(C(=O)OCCOc2cc(=C(C#N)C#N)c(OCCOC(=O)c3ccc(C)cc3S(=O)(=O)O)cc2=C(C#N)C#N)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C32H24N4O12S2/c1-19-3-5-23(29(11-19)49(39,40)41)31(37)47-9-7-45-27-13-26(22(17-35)18-36)28(14-25(27)21(15-33)16-34)46-8-10-48-32(38)24-6-4-20(2)12-30(24)50(42,43)44/h3-6,11-14H,7-10H2,1-2H3,(H,39,40,41)(H,42,43,44) |
| InChIKey | PIHOOORJRAUDNM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 274.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|