C30H20N4O9S — CID 76790728
2-[2-[4-(2-benzoyloxyethoxy)-3,6-bis[cyano(isocyano)methylidene]cyclohexa-1,4-dien-1-yl]oxyethoxycarbonyl]benzenesulfonic acid (PubChem CID 76790728) has the molecular formula C30H20N4O9S and a molecular weight of 612.58 g/mol. Its IUPAC name is 2-[2-[4-(2-benzoyloxyethoxy)-3,6-bis[cyano(isocyano)methylidene]cyclohexa-1,4-dien-1-yl]oxyethoxycarbonyl]benzenesulfonic acid.
| Compound Name | 2-[2-[4-(2-benzoyloxyethoxy)-3,6-bis[cyano(isocyano)methylidene]cyclohexa-1,4-dien-1-yl]oxyethoxycarbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 76790728 |
| Molecular Formula | C30H20N4O9S |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | 2-[2-[4-(2-benzoyloxyethoxy)-3,6-bis[cyano(isocyano)methylidene]cyclohexa-1,4-dien-1-yl]oxyethoxycarbonyl]benzenesulfonic acid |
| SMILES | [C-]#[N+]C(C#N)=c1cc(OCCOC(=O)c2ccccc2S(=O)(=O)O)c(=C(C#N)[N+]#[C-])cc1OCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H20N4O9S/c1-33-24(18-31)22-17-27(41-13-15-43-30(36)21-10-6-7-11-28(21)44(37,38)39)23(25(19-32)34-2)16-26(22)40-12-14-42-29(35)20-8-4-3-5-9-20/h3-11,16-17H,12-15H2,(H,37,38,39) |
| InChIKey | QNOYQULGLIVPTF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 181.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|