C36H35N4O7S- — CID 59032493
4-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-phenylbutoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]-2-phenylbutane-1-sulfonate (PubChem CID 59032493) has the molecular formula C36H35N4O7S- and a molecular weight of 667.76 g/mol. Its IUPAC name is 4-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-phenylbutoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]-2-phenylbutane-1-sulfonate.
| Compound Name | 4-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-phenylbutoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]-2-phenylbutane-1-sulfonate |
|---|---|
| PubChem CID | 59032493 |
| Molecular Formula | C36H35N4O7S- |
| Molecular Weight | 667.76 g/mol |
| Exact Mass | 667.22 |
| IUPAC Name | 4-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-phenylbutoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]-2-phenylbutane-1-sulfonate |
| SMILES | [C-]#[N+]/C(C#N)=c1/cc(OCCOCCC(CS(=O)(=O)[O-])c2ccccc2)/c(=C(\C#N)[N+]#[C-])cc1OCCOCCC(C)c1ccccc1 |
| InChI | InChI=1S/C36H36N4O7S/c1-27(28-10-6-4-7-11-28)14-16-44-18-20-46-35-22-32(34(25-38)40-3)36(23-31(35)33(24-37)39-2)47-21-19-45-17-15-30(26-48(41,42)43)29-12-8-5-9-13-29/h4-13,22-23,27,30H,14-21,26H2,1H3,(H,41,42,43)/p-1/b33-31-,34-32+ |
| InChIKey | APYBYTDGBAPBFL-IUQQBYGBSA-M |
| XLogP | 4.49 |
| TPSA | 150.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.76 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|