C34H32N4O10S2 — CID 74062061
3-[2-[3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-phenyl-3-sulfopropoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]-1-phenylpropane-1-sulfonic acid (PubChem CID 74062061) has the molecular formula C34H32N4O10S2 and a molecular weight of 720.78 g/mol. Its IUPAC name is 3-[2-[3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-phenyl-3-sulfopropoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]-1-phenylpropane-1-sulfonic acid.
| Compound Name | 3-[2-[3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-phenyl-3-sulfopropoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]-1-phenylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 74062061 |
| Molecular Formula | C34H32N4O10S2 |
| Molecular Weight | 720.78 g/mol |
| Exact Mass | 720.16 |
| IUPAC Name | 3-[2-[3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-phenyl-3-sulfopropoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]-1-phenylpropane-1-sulfonic acid |
| SMILES | [C-]#[N+]C(C#N)=c1cc(OCCOCCC(c2ccccc2)S(=O)(=O)O)c(=C(C#N)[N+]#[C-])cc1OCCOCCC(c1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C34H32N4O10S2/c1-37-29(23-35)27-21-32(48-20-18-46-16-14-34(50(42,43)44)26-11-7-4-8-12-26)28(30(24-36)38-2)22-31(27)47-19-17-45-15-13-33(49(39,40)41)25-9-5-3-6-10-25/h3-12,21-22,33-34H,13-20H2,(H,39,40,41)(H,42,43,44) |
| InChIKey | KEVVOOINSFDSRW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 201.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|