C22H26N4O10S2 — CID 59032505
3-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-[3-(trihydroxy-λ4-sulfanyl)propoxy]ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]propane-1-sulfonic acid (PubChem CID 59032505) has the molecular formula C22H26N4O10S2 and a molecular weight of 570.60 g/mol. Its IUPAC name is 3-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-[3-(trihydroxy-λ4-sulfanyl)propoxy]ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-[3-(trihydroxy-λ4-sulfanyl)propoxy]ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59032505 |
| Molecular Formula | C22H26N4O10S2 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | 3-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-[3-(trihydroxy-λ4-sulfanyl)propoxy]ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]propane-1-sulfonic acid |
| SMILES | [C-]#[N+]/C(C#N)=c1/cc(OCCOCCCS(=O)(=O)O)/c(=C(\C#N)[N+]#[C-])cc1OCCOCCCS(O)(O)O |
| InChI | InChI=1S/C22H26N4O10S2/c1-25-19(15-23)17-13-22(36-10-8-34-6-4-12-38(30,31)32)18(20(16-24)26-2)14-21(17)35-9-7-33-5-3-11-37(27,28)29/h13-14,27-29H,3-12H2,(H,30,31,32)/b19-17-,20-18+ |
| InChIKey | GMHWWMPPIODGFV-YAFCTCPESA-N |
| XLogP | 1.47 |
| TPSA | 208.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|