C38H40N4O7S — CID 59032516
2-benzyl-4-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-methyl-4-phenylbutoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]butane-1-sulfonic acid (PubChem CID 59032516) has the molecular formula C38H40N4O7S and a molecular weight of 696.83 g/mol. Its IUPAC name is 2-benzyl-4-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-methyl-4-phenylbutoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]butane-1-sulfonic acid.
| Compound Name | 2-benzyl-4-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-methyl-4-phenylbutoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59032516 |
| Molecular Formula | C38H40N4O7S |
| Molecular Weight | 696.83 g/mol |
| Exact Mass | 696.26 |
| IUPAC Name | 2-benzyl-4-[2-[(3Z,6E)-3,6-bis[cyano(isocyano)methylidene]-4-[2-(3-methyl-4-phenylbutoxy)ethoxy]cyclohexa-1,4-dien-1-yl]oxyethoxy]butane-1-sulfonic acid |
| SMILES | [C-]#[N+]/C(C#N)=c1/cc(OCCOCCC(Cc2ccccc2)CS(=O)(=O)O)/c(=C(\C#N)[N+]#[C-])cc1OCCOCCC(C)Cc1ccccc1 |
| InChI | InChI=1S/C38H40N4O7S/c1-29(22-30-10-6-4-7-11-30)14-16-46-18-20-48-37-24-34(36(27-40)42-3)38(25-33(37)35(26-39)41-2)49-21-19-47-17-15-32(28-50(43,44)45)23-31-12-8-5-9-13-31/h4-13,24-25,29,32H,14-23,28H2,1H3,(H,43,44,45)/b35-33-,36-34+ |
| InChIKey | JVJRXGSGWFKPGL-FFROBNHHSA-N |
| XLogP | 4.99 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|