C10N6 — CID 20588541
2,4,4-triisocyanobuta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 20588541) has the molecular formula C10N6 and a molecular weight of 204.15 g/mol. Its IUPAC name is 2,4,4-triisocyanobuta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | 2,4,4-triisocyanobuta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 20588541 |
| Molecular Formula | C10N6 |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2,4,4-triisocyanobuta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C(C#N)C([N+]#[C-])=C(C#N)C#N |
| InChI | InChI=1S/C10N6/c1-14-9(7(4-11)5-12)8(6-13)10(15-2)16-3 |
| InChIKey | YHBWEBAAJQWZJO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|