C6H3F3N2 — CID 23386823
(Z)-4,4,4-trifluoro-2-isocyano-3-methylbut-2-enenitrile (PubChem CID 23386823) has the molecular formula C6H3F3N2 and a molecular weight of 160.10 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-2-isocyano-3-methylbut-2-enenitrile.
| Compound Name | (Z)-4,4,4-trifluoro-2-isocyano-3-methylbut-2-enenitrile |
|---|---|
| PubChem CID | 23386823 |
| Molecular Formula | C6H3F3N2 |
| Molecular Weight | 160.10 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | (Z)-4,4,4-trifluoro-2-isocyano-3-methylbut-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(/C)C(F)(F)F |
| InChI | InChI=1S/C6H3F3N2/c1-4(6(7,8)9)5(3-10)11-2/h1H3/b5-4- |
| InChIKey | CKNOLJIAADCKBB-PLNGDYQASA-N |
| XLogP | 2.27 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.10 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|