About 3-oxopropyl carbamodithioate
3-oxopropyl carbamodithioate (PubChem CID 55290322) has the molecular formula C4H7NOS2
and a molecular weight of 149.24 g/mol. Its IUPAC name is 3-oxopropyl carbamodithioate.
Molecular Properties
| Compound Name | 3-oxopropyl carbamodithioate |
| PubChem CID | 55290322 |
| Molecular Formula | C4H7NOS2 |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.00 |
| IUPAC Name | 3-oxopropyl carbamodithioate |
| SMILES | NC(=S)SCCC=O |
| InChI | InChI=1S/C4H7NOS2/c5-4(7)8-3-1-2-6/h2H,1,3H2,(H2,5,7) |
| InChIKey | AWKBMLMHPXRWRZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-oxopropyl carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxopropyl carbamodithioate?
The IUPAC name of 3-oxopropyl carbamodithioate (CID 55290322) is 3-oxopropyl carbamodithioate.
What is the SMILES notation for 3-oxopropyl carbamodithioate?
The canonical SMILES for 3-oxopropyl carbamodithioate is NC(=S)SCCC=O.
What is the InChIKey of 3-oxopropyl carbamodithioate?
The InChIKey is AWKBMLMHPXRWRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS2/c5-4(7)8-3-1-2-6/h2H,1,3H2,(H2,5,7).
What are the key properties of 3-oxopropyl carbamodithioate?
3-oxopropyl carbamodithioate has a molecular weight of 149.24 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxopropyl carbamodithioate is sourced from PubChem (CID 55290322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).